CAS 1236676-48-4 is the registry number for 6-Chloro-3-(propan-2-yl)-1,2,3,4-tetrahydroquinoxalin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-chloro-3-propan-2-yl-3,4-dihydro-1H-quinoxalin-2-one (CAS 1236676-48-4) is a chemical compound with the molecular formula C11H13ClN2O and a molecular weight of 224.68 g/mol. IUPAC name: 6-chloro-3-propan-2-yl-3,4-dihydro-1H-quinoxalin-2-one. InChIKey: YIOSQHYRDWEKAJ-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | 6-chloro-3-propan-2-yl-3,4-dihydro-1H-quinoxalin-2-one |
| InChIKey | YIOSQHYRDWEKAJ-UHFFFAOYSA-N |
| SMILES | CC(C)C1C(=O)NC2=C(N1)C=C(C=C2)Cl |
Computed by PubChem (NCBI)