CAS 123685-25-6 is the registry number for Methyl 2-bromo-3,4-dihydroxy-5-methoxybenzoate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-bromo-3,4-dihydroxy-5-methoxybenzoate (CAS 123685-25-6) is a chemical compound with the molecular formula C9H9BrO5 and a molecular weight of 277.07 g/mol. IUPAC name: methyl 2-bromo-3,4-dihydroxy-5-methoxybenzoate. InChIKey: BKWQKJNQARMXHL-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO5 |
|---|---|
| Molecular weight | 277.07 g/mol |
| IUPAC name | methyl 2-bromo-3,4-dihydroxy-5-methoxybenzoate |
| InChIKey | BKWQKJNQARMXHL-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1)C(=O)OC)Br)O)O |
Computed by PubChem (NCBI)