CAS 1237431-49-0 is the registry number for 6-(Pentafluoroethyl)pyridine-2-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
6-(1,1,2,2,2-pentafluoroethyl)pyridine-2-carbonitrile (CAS 1237431-49-0) is a chemical compound with the molecular formula C8H3F5N2 and a molecular weight of 222.11 g/mol. IUPAC name: 6-(1,1,2,2,2-pentafluoroethyl)pyridine-2-carbonitrile. InChIKey: JHTRASHYGAYPTG-UHFFFAOYSA-N.
| Molecular formula | C8H3F5N2 |
|---|---|
| Molecular weight | 222.11 g/mol |
| IUPAC name | 6-(1,1,2,2,2-pentafluoroethyl)pyridine-2-carbonitrile |
| InChIKey | JHTRASHYGAYPTG-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(C(F)(F)F)(F)F)C#N |
Computed by PubChem (NCBI)