CAS 1237495-00-9 is the registry number for (1S,2R)-2-(3-Fluorophenyl)cyclopropan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1S,2R)-2-(3-fluorophenyl)cyclopropan-1-amine (CAS 1237495-00-9) is a chemical compound with the molecular formula C9H10FN and a molecular weight of 151.18 g/mol. IUPAC name: trans-(1S,2R)-2-(3-fluorophenyl)cyclopropan-1-amine. InChIKey: OXGGARNLAOPVNV-BDAKNGLRSA-N.
| Molecular formula | C9H10FN |
|---|---|
| Molecular weight | 151.18 g/mol |
| IUPAC name | trans-(1S,2R)-2-(3-fluorophenyl)cyclopropan-1-amine |
| InChIKey | OXGGARNLAOPVNV-BDAKNGLRSA-N |
| SMILES | C1[C@@H]([C@H]1N)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)