Products 1237496-62-6
CAS 1237496-62-6 is the registry number for 3’-Deoxy-N6-isopentenyl adenosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R,5S)-5-(hydroxymethyl)-2-[6-(3-methylbut-2-enylamino)purin-9-yl]oxolan-3-ol (CAS 1237496-62-6) is a chemical compound with the molecular formula C15H21N5O3 and a molecular weight of 319.36 g/mol. IUPAC name: (2R,3R,5S)-5-(hydroxymethyl)-2-[6-(3-methylbut-2-enylamino)purin-9-yl]oxolan-3-ol. InChIKey: JJWOSCDNNFJUAS-FIXISWKDSA-N.
| Molecular formula | C15H21N5O3 |
|---|---|
| Molecular weight | 319.36 g/mol |
| IUPAC name | (2R,3R,5S)-5-(hydroxymethyl)-2-[6-(3-methylbut-2-enylamino)purin-9-yl]oxolan-3-ol |
| InChIKey | JJWOSCDNNFJUAS-FIXISWKDSA-N |
| SMILES | CC(=CCNC1=C2C(=NC=N1)N(C=N2)[C@H]3[C@@H](C[C@H](O3)CO)O)C |
Computed by PubChem (NCBI)
Synonyms:
orb1908535, 3a?Deoxy-N6-isopentenyl adenosine