CAS 123767-44-2 appears in our catalog under these names: 1-(Azidomethyl)-3-methoxybenzene (~0.5 M in MTBE), 1-(Azidomethyl)-3-methoxybenzene. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 500mg, 50mg, 0,5g, 5g.
1-(azidomethyl)-3-methoxybenzene (CAS 123767-44-2) is a chemical compound with the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. IUPAC name: 1-(azidomethyl)-3-methoxybenzene. InChIKey: NGSNSSXJWWLJAX-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O |
|---|---|
| Molecular weight | 163.18 g/mol |
| IUPAC name | 1-(azidomethyl)-3-methoxybenzene |
| InChIKey | NGSNSSXJWWLJAX-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)CN=[N+]=[N-] |
Computed by PubChem (NCBI)