CAS 1238259-91-0 is the registry number for 4-Bromo-3,5-bis(2-methylphenyl)-1H-pyrazole. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-bromo-3,5-bis(2-methylphenyl)-1H-pyrazole (CAS 1238259-91-0) is a chemical compound with the molecular formula C17H15BrN2 and a molecular weight of 327.2 g/mol. IUPAC name: 4-bromo-3,5-bis(2-methylphenyl)-1H-pyrazole. InChIKey: JAFHMKVFLZKUGH-UHFFFAOYSA-N.
| Molecular formula | C17H15BrN2 |
|---|---|
| Molecular weight | 327.2 g/mol |
| IUPAC name | 4-bromo-3,5-bis(2-methylphenyl)-1H-pyrazole |
| InChIKey | JAFHMKVFLZKUGH-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=C(C(=NN2)C3=CC=CC=C3C)Br |
Computed by PubChem (NCBI)