CAS 123828-22-8 is the registry number for 2-(4-Fluoro-phenyl)-thiomorpholin-3-one, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-(4-fluorophenyl)thiomorpholin-3-one (CAS 123828-22-8) is a chemical compound with the molecular formula C10H10FNOS and a molecular weight of 211.26 g/mol. IUPAC name: 2-(4-fluorophenyl)thiomorpholin-3-one. InChIKey: JRSUYHOXEXEDLL-UHFFFAOYSA-N.
| Molecular formula | C10H10FNOS |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 2-(4-fluorophenyl)thiomorpholin-3-one |
| InChIKey | JRSUYHOXEXEDLL-UHFFFAOYSA-N |
| SMILES | C1CSC(C(=O)N1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)