CAS 1238864-82-8 is the registry number for 4-(p-tolyl)-3-(trifluoromethyl)-1H-pyrazol-5-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
4-(4-methylphenyl)-5-(trifluoromethyl)-1H-pyrazol-3-amine;hydrochloride (CAS 1238864-82-8) is a chemical compound with the molecular formula C11H11ClF3N3 and a molecular weight of 277.67 g/mol. IUPAC name: 4-(4-methylphenyl)-5-(trifluoromethyl)-1H-pyrazol-3-amine;hydrochloride. InChIKey: FESMNTLHIJUPRR-UHFFFAOYSA-N.
| Molecular formula | C11H11ClF3N3 |
|---|---|
| Molecular weight | 277.67 g/mol |
| IUPAC name | 4-(4-methylphenyl)-5-(trifluoromethyl)-1H-pyrazol-3-amine;hydrochloride |
| InChIKey | FESMNTLHIJUPRR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(NN=C2N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)