CAS 12389-75-2 appears in our catalog under these names: Sodium hydrogen ferric dtpa, 95%, SodiumhydrogenferricDTPA, 95%, Sodium Hydrogen Ferric DTPA, Iron sodium DTPA, 98%+,RG, 98%+,RG. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg, 100g, 25g, 500g.
Sodium;2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetate;iron (CAS 12389-75-2) is a chemical compound with the molecular formula C14H22FeN3NaO10 and a molecular weight of 471.17 g/mol. IUPAC name: sodium;2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetate;iron. InChIKey: QPYLVHZXLVRPDD-UHFFFAOYSA-M.
| Molecular formula | C14H22FeN3NaO10 |
|---|---|
| Molecular weight | 471.17 g/mol |
| IUPAC name | sodium;2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetate;iron |
| InChIKey | QPYLVHZXLVRPDD-UHFFFAOYSA-M |
| SMILES | C(CN(CC(=O)O)CC(=O)O)N(CCN(CC(=O)O)CC(=O)O)CC(=O)[O-].[Na+].[Fe] |
Computed by PubChem (NCBI)