CAS 123948-28-7 appears in our catalog under these names: H-Boroproline Pinacol HCl 95%, 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine hydrochloride, 95%, 95%, 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine hydrochloride, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine;hydrochloride (CAS 123948-28-7) is a chemical compound with the molecular formula C10H21BClNO2 and a molecular weight of 233.54 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine;hydrochloride. InChIKey: KACPBWGBUOFTBL-UHFFFAOYSA-N.
| Molecular formula | C10H21BClNO2 |
|---|---|
| Molecular weight | 233.54 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine;hydrochloride |
| InChIKey | KACPBWGBUOFTBL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCCN2.Cl |
Computed by PubChem (NCBI)