CAS 123952-20-5 appears in our catalog under these names: H–Tyr–Thr–NH₂, H-Tyr-Thr-NH2 hydrochloride salt. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 500mg, 1000mg.
(2S,3R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxybutanamide;hydrochloride (CAS 123952-20-5) is a chemical compound with the molecular formula C13H20ClN3O4 and a molecular weight of 317.77 g/mol. IUPAC name: (2S,3R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxybutanamide;hydrochloride. InChIKey: CVLXAOCBKNTGMI-MTTHVJSVSA-N.
| Molecular formula | C13H20ClN3O4 |
|---|---|
| Molecular weight | 317.77 g/mol |
| IUPAC name | (2S,3R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxybutanamide;hydrochloride |
| InChIKey | CVLXAOCBKNTGMI-MTTHVJSVSA-N |
| SMILES | C[C@H]([C@@H](C(=O)N)NC(=O)[C@H](CC1=CC=C(C=C1)O)N)O.Cl |
Computed by PubChem (NCBI)