CAS 1239578-80-3 appears in our catalog under these names: NP–1815–PX sodium, NP-1815-PX (sodium), 99%, 99%, NP-1815-PX (sodium), 99.62%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10 mg, 50 mg, 25 mg, 100 mg, 5 mg.
Sodium 5-[3-(5-sulfanylidene-1-oxa-2-aza-4-azanidacyclopent-2-en-3-yl)phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione (CAS 1239578-80-3) is a chemical compound with the molecular formula C21H13N4NaO3S and a molecular weight of 424.4 g/mol. IUPAC name: sodium 5-[3-(5-sulfanylidene-1-oxa-2-aza-4-azanidacyclopent-2-en-3-yl)phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione. InChIKey: MIBCQKIVVIBTLQ-UHFFFAOYSA-M.
| Molecular formula | C21H13N4NaO3S |
|---|---|
| Molecular weight | 424.4 g/mol |
| IUPAC name | sodium 5-[3-(5-sulfanylidene-1-oxa-2-aza-4-azanidacyclopent-2-en-3-yl)phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
| InChIKey | MIBCQKIVVIBTLQ-UHFFFAOYSA-M |
| SMILES | C1C(=O)NC2=C(C=CC3=CC=CC=C32)N(C1=O)C4=CC=CC(=C4)C5=NOC(=S)[N-]5.[Na+] |
Computed by PubChem (NCBI)