CAS 1239662-48-6 appears in our catalog under these names: Tedizolid Pyrophosphate Ester, Tedizolid Impurity 55. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(5R)-3-[3-fluoro-4-[6-(2-methyltetrazol-5-yl)-3-pyridinyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl phosphono hydrogen phosphate (CAS 1239662-48-6) is a chemical compound with the molecular formula C17H17FN6O9P2 and a molecular weight of 530.3 g/mol. IUPAC name: [(5R)-3-[3-fluoro-4-[6-(2-methyltetrazol-5-yl)-3-pyridinyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl phosphono hydrogen phosphate. InChIKey: PVIASTLQSNHOKD-GFCCVEGCSA-N.
| Molecular formula | C17H17FN6O9P2 |
|---|---|
| Molecular weight | 530.3 g/mol |
| IUPAC name | [(5R)-3-[3-fluoro-4-[6-(2-methyltetrazol-5-yl)-3-pyridinyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl phosphono hydrogen phosphate |
| InChIKey | PVIASTLQSNHOKD-GFCCVEGCSA-N |
| SMILES | CN1N=C(N=N1)C2=NC=C(C=C2)C3=C(C=C(C=C3)N4C[C@@H](OC4=O)COP(=O)(O)OP(=O)(O)O)F |
Computed by PubChem (NCBI)