CAS 123971-41-5 is the registry number for 4-(2,3,4-Trichlorophenyl)thiazol-2-amine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-(2,3,4-trichlorophenyl)-1,3-thiazol-2-amine (CAS 123971-41-5) is a chemical compound with the molecular formula C9H5Cl3N2S and a molecular weight of 279.6 g/mol. IUPAC name: 4-(2,3,4-trichlorophenyl)-1,3-thiazol-2-amine. InChIKey: MXKOHKRMIYFKNZ-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl3N2S |
|---|---|
| Molecular weight | 279.6 g/mol |
| IUPAC name | 4-(2,3,4-trichlorophenyl)-1,3-thiazol-2-amine |
| InChIKey | MXKOHKRMIYFKNZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C2=CSC(=N2)N)Cl)Cl)Cl |
Computed by PubChem (NCBI)