CAS 1239851-29-6 is the registry number for 1-[3-(3-Methyl-1,2,4-oxadiazol-5-yl)pyridin-2-yl]-1h-imidazole-4-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]imidazole-4-carboxylic acid (CAS 1239851-29-6) is a chemical compound with the molecular formula C12H9N5O3 and a molecular weight of 271.23 g/mol. IUPAC name: 1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]imidazole-4-carboxylic acid. InChIKey: PYXGZIQMSOOPAL-UHFFFAOYSA-N.
| Molecular formula | C12H9N5O3 |
|---|---|
| Molecular weight | 271.23 g/mol |
| IUPAC name | 1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]imidazole-4-carboxylic acid |
| InChIKey | PYXGZIQMSOOPAL-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)C2=C(N=CC=C2)N3C=C(N=C3)C(=O)O |
Computed by PubChem (NCBI)