CAS 123986-75-4 appears in our catalog under these names: (1S)-2,2-Difluoro-1-phenylethan-1-ol, 95%, (1S)-2,2-Difluoro-1-phenylethan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 50mg, 0,5g.
(1S)-2,2-difluoro-1-phenylethanol (CAS 123986-75-4) is a chemical compound with the molecular formula C8H8F2O and a molecular weight of 158.14 g/mol. IUPAC name: (1S)-2,2-difluoro-1-phenylethanol. InChIKey: XOYZGEQHDLLDHZ-ZETCQYMHSA-N.
| Molecular formula | C8H8F2O |
|---|---|
| Molecular weight | 158.14 g/mol |
| IUPAC name | (1S)-2,2-difluoro-1-phenylethanol |
| InChIKey | XOYZGEQHDLLDHZ-ZETCQYMHSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](C(F)F)O |
Computed by PubChem (NCBI)