CAS 1240-04-6 appears in our catalog under these names: Potassium estrone sulfate, Estrone sulfate potassium/ 99.05% (existing batch purity), Estrone sulfate potassium, ESTRONE 3-SULFATE POTASSIUM, Estrone 3-sulfate potassium salt, 98%, 98%. Offered by: Chemat Brand, TargetMol, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: on request, 2mg, 5mg, 10mg, 25mg, 10mM (in 1ml dmso), 100MG, 1 mg.
Potassium [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfate (CAS 1240-04-6) is a chemical compound with the molecular formula C18H21KO5S and a molecular weight of 388.5 g/mol. IUPAC name: potassium [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfate. InChIKey: CUQHOFAEIPGLBH-ZFINNJDLSA-M.
| Molecular formula | C18H21KO5S |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | potassium [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfate |
| InChIKey | CUQHOFAEIPGLBH-ZFINNJDLSA-M |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3C=CC(=C4)OS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)