CAS 1240249-76-6 appears in our catalog under these names: Luliconazole-Z-Isomer, Luliconazole Impurity B, Luliconazole Impurity 1(Luliconazole-Z-Isomer). Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2Z)-2-[(4R)-4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]-2-imidazol-1-ylacetonitrile (CAS 1240249-76-6) is a chemical compound with the molecular formula C14H9Cl2N3S2 and a molecular weight of 354.3 g/mol. IUPAC name: (2Z)-2-[(4R)-4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]-2-imidazol-1-ylacetonitrile. InChIKey: YTAOBBFIOAEMLL-BSHRGCEOSA-N.
| Molecular formula | C14H9Cl2N3S2 |
|---|---|
| Molecular weight | 354.3 g/mol |
| IUPAC name | (2Z)-2-[(4R)-4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]-2-imidazol-1-ylacetonitrile |
| InChIKey | YTAOBBFIOAEMLL-BSHRGCEOSA-N |
| SMILES | C1[C@H](S/C(=C(/C#N)\N2C=CN=C2)/S1)C3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)