CAS 1240257-48-0 appears in our catalog under these names: 3-Methyl-5-(pentafluorosulfur)benzyl bromide, 95%, 3-Methyl-5-(pentafluorothio)benzyl bromide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
[3-(bromomethyl)-5-methylphenyl]-pentafluoro-lambda6-sulfane (CAS 1240257-48-0) is a chemical compound with the molecular formula C8H8BrF5S and a molecular weight of 311.11 g/mol. IUPAC name: [3-(bromomethyl)-5-methylphenyl]-pentafluoro-lambda6-sulfane. InChIKey: ZRHPUHTTXXCZFI-UHFFFAOYSA-N.
| Molecular formula | C8H8BrF5S |
|---|---|
| Molecular weight | 311.11 g/mol |
| IUPAC name | [3-(bromomethyl)-5-methylphenyl]-pentafluoro-lambda6-sulfane |
| InChIKey | ZRHPUHTTXXCZFI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)S(F)(F)(F)(F)F)CBr |
Computed by PubChem (NCBI)