CAS 1240257-95-7 appears in our catalog under these names: 3-Bromo-5-(pentafluorosulfur)aniline, 95%, 3-Bromo-5-(pentafluorosulfur)aniline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
3-bromo-5-(pentafluoro-lambda6-sulfanyl)aniline (CAS 1240257-95-7) is a chemical compound with the molecular formula C6H5BrF5NS and a molecular weight of 298.07 g/mol. IUPAC name: 3-bromo-5-(pentafluoro-lambda6-sulfanyl)aniline. InChIKey: HCROKBUNMALNHZ-UHFFFAOYSA-N.
| Molecular formula | C6H5BrF5NS |
|---|---|
| Molecular weight | 298.07 g/mol |
| IUPAC name | 3-bromo-5-(pentafluoro-lambda6-sulfanyl)aniline |
| InChIKey | HCROKBUNMALNHZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1S(F)(F)(F)(F)F)Br)N |
Computed by PubChem (NCBI)