Products 1240398-15-5
CAS 1240398-15-5 appears in our catalog under these names: 11-Dehydro Thromboxane B2-d4, 11–dehydro Thromboxane B2–d4, 11-Dehydro-thromboxane B2-d4. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 100μg, 25μg, 50μg, 500μg, 2.5 mg, 25 μg.
(Z)-3,3,4,4-tetradeuterio-7-[(2R,3S,4S)-4-hydroxy-2-[(E,3R)-3-hydroxyoct-1-enyl]-6-oxooxan-3-yl]hept-5-enoic acid (CAS 1240398-15-5) is a chemical compound with the molecular formula C20H32O6 and a molecular weight of 372.5 g/mol. IUPAC name: (Z)-3,3,4,4-tetradeuterio-7-[(2R,3S,4S)-4-hydroxy-2-[(E,3R)-3-hydroxyoct-1-enyl]-6-oxooxan-3-yl]hept-5-enoic acid. InChIKey: KJYIVXDPWBUJBQ-ZUCLGDGSSA-N.
| Molecular formula | C20H32O6 |
|---|---|
| Molecular weight | 372.5 g/mol |
| IUPAC name | (Z)-3,3,4,4-tetradeuterio-7-[(2R,3S,4S)-4-hydroxy-2-[(E,3R)-3-hydroxyoct-1-enyl]-6-oxooxan-3-yl]hept-5-enoic acid |
| InChIKey | KJYIVXDPWBUJBQ-ZUCLGDGSSA-N |
| SMILES | [2H]C([2H])(CC(=O)O)C([2H])([2H])/C=C\C[C@H]1[C@H](CC(=O)O[C@@H]1/C=C/[C@@H](CCCCC)O)O |
Computed by PubChem (NCBI)
Synonyms:
11-dehydro Thromboxane B2-d4