CAS 124052-68-2 appears in our catalog under these names: Furan-2,5-dicarboxamide 95%, Furan-2,5-dicarboxamide, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Furan-2,5-dicarboxamide (CAS 124052-68-2) is a chemical compound with the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. IUPAC name: furan-2,5-dicarboxamide. InChIKey: YVORDIMCXSWNQQ-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O3 |
|---|---|
| Molecular weight | 154.12 g/mol |
| IUPAC name | furan-2,5-dicarboxamide |
| InChIKey | YVORDIMCXSWNQQ-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)C(=O)N)C(=O)N |
Computed by PubChem (NCBI)