CAS 1240526-18-4 is the registry number for 5-Chloro-6-((3,4-difluorophenyl)amino)pyridine-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-chloro-6-(3,4-difluoroanilino)pyridine-3-carbonitrile (CAS 1240526-18-4) is a chemical compound with the molecular formula C12H6ClF2N3 and a molecular weight of 265.64 g/mol. IUPAC name: 5-chloro-6-(3,4-difluoroanilino)pyridine-3-carbonitrile. InChIKey: PXJCFORPLGOVNK-UHFFFAOYSA-N.
| Molecular formula | C12H6ClF2N3 |
|---|---|
| Molecular weight | 265.64 g/mol |
| IUPAC name | 5-chloro-6-(3,4-difluoroanilino)pyridine-3-carbonitrile |
| InChIKey | PXJCFORPLGOVNK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC2=C(C=C(C=N2)C#N)Cl)F)F |
Computed by PubChem (NCBI)