CAS 1240526-19-5 appears in our catalog under these names: 2-Chloro-N-(5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-yl)acetamide, 95%, 2-Chloro-N-(5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-yl)acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-chloro-N-[5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-yl]acetamide (CAS 1240526-19-5) is a chemical compound with the molecular formula C6H5ClF3N3O2 and a molecular weight of 243.57 g/mol. IUPAC name: 2-chloro-N-[5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-yl]acetamide. InChIKey: RSQOVNGMOGJHNI-UHFFFAOYSA-N.
| Molecular formula | C6H5ClF3N3O2 |
|---|---|
| Molecular weight | 243.57 g/mol |
| IUPAC name | 2-chloro-N-[5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-yl]acetamide |
| InChIKey | RSQOVNGMOGJHNI-UHFFFAOYSA-N |
| SMILES | C(C1=NN=C(O1)NC(=O)CCl)C(F)(F)F |
Computed by PubChem (NCBI)