CAS 1240527-24-5 is the registry number for 4-(4-Methyl-2,5-dioxoimidazolidin-4-yl)benzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzenesulfonamide (CAS 1240527-24-5) is a chemical compound with the molecular formula C10H11N3O4S and a molecular weight of 269.28 g/mol. IUPAC name: 4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzenesulfonamide. InChIKey: FESXHSNRDOBCFP-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O4S |
|---|---|
| Molecular weight | 269.28 g/mol |
| IUPAC name | 4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzenesulfonamide |
| InChIKey | FESXHSNRDOBCFP-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)C2=CC=C(C=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)