CAS 1240527-29-0 appears in our catalog under these names: 2-Amino-N-(4-(1H-1,2,4-triazol-1-yl)phenyl)acetamide dihydrochloride, 95%, 2-Amino-N-(4-(1H-1,2,4-triazol-1-yl)phenyl)acetamide dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-amino-N-[4-(1,2,4-triazol-1-yl)phenyl]acetamide;dihydrochloride (CAS 1240527-29-0) is a chemical compound with the molecular formula C10H13Cl2N5O and a molecular weight of 290.15 g/mol. IUPAC name: 2-amino-N-[4-(1,2,4-triazol-1-yl)phenyl]acetamide;dihydrochloride. InChIKey: PPFVRXSAGPCFQE-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N5O |
|---|---|
| Molecular weight | 290.15 g/mol |
| IUPAC name | 2-amino-N-[4-(1,2,4-triazol-1-yl)phenyl]acetamide;dihydrochloride |
| InChIKey | PPFVRXSAGPCFQE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)CN)N2C=NC=N2.Cl.Cl |
Computed by PubChem (NCBI)