CAS 1240527-56-3 is the registry number for 2-(2-(4-Fluorophenyl)-1,3-oxazol-4-yl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethanamine;hydrochloride (CAS 1240527-56-3) is a chemical compound with the molecular formula C11H12ClFN2O and a molecular weight of 242.68 g/mol. IUPAC name: 2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethanamine;hydrochloride. InChIKey: WAEKBXHQGPJWNH-UHFFFAOYSA-N.
| Molecular formula | C11H12ClFN2O |
|---|---|
| Molecular weight | 242.68 g/mol |
| IUPAC name | 2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethanamine;hydrochloride |
| InChIKey | WAEKBXHQGPJWNH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CO2)CCN)F.Cl |
Computed by PubChem (NCBI)