CAS 1240527-92-7 appears in our catalog under these names: 2-Nitropyridin-3-yl 4-methylbenzene-1-sulfonate, 95%, 2-Nitropyridin-3-yl 4-methylbenzene-1-sulfonate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
(2-nitro-3-pyridinyl) 4-methylbenzenesulfonate (CAS 1240527-92-7) is a chemical compound with the molecular formula C12H10N2O5S and a molecular weight of 294.29 g/mol. IUPAC name: (2-nitro-3-pyridinyl) 4-methylbenzenesulfonate. InChIKey: BZFLDPUEENDUPJ-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O5S |
|---|---|
| Molecular weight | 294.29 g/mol |
| IUPAC name | (2-nitro-3-pyridinyl) 4-methylbenzenesulfonate |
| InChIKey | BZFLDPUEENDUPJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2=C(N=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)