CAS 1240528-61-3 appears in our catalog under these names: Sodium 2-(4-methyl-5-phenyl-4H-1,2,4-triazol-3-yl)acetate, 95%, Sodium 2-(4-methyl-5-phenyl-4H-1,2,4-triazol-3-yl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
Sodium 2-(4-methyl-5-phenyl-1,2,4-triazol-3-yl)acetate (CAS 1240528-61-3) is a chemical compound with the molecular formula C11H10N3NaO2 and a molecular weight of 239.21 g/mol. IUPAC name: sodium 2-(4-methyl-5-phenyl-1,2,4-triazol-3-yl)acetate. InChIKey: RARHJXNBIAVCCT-UHFFFAOYSA-M.
| Molecular formula | C11H10N3NaO2 |
|---|---|
| Molecular weight | 239.21 g/mol |
| IUPAC name | sodium 2-(4-methyl-5-phenyl-1,2,4-triazol-3-yl)acetate |
| InChIKey | RARHJXNBIAVCCT-UHFFFAOYSA-M |
| SMILES | CN1C(=NN=C1C2=CC=CC=C2)CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)