CAS 1240529-28-5 appears in our catalog under these names: 1-(4-Chloro-2-fluorobenzoyl)piperazine hydrochloride, 95%, 1-(4-Chloro-2-fluorobenzoyl)piperazine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
(4-chloro-2-fluorophenyl)-piperazin-1-ylmethanone;hydrochloride (CAS 1240529-28-5) is a chemical compound with the molecular formula C11H13Cl2FN2O and a molecular weight of 279.13 g/mol. IUPAC name: (4-chloro-2-fluorophenyl)-piperazin-1-ylmethanone;hydrochloride. InChIKey: XGUVZAAIVISQDJ-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2FN2O |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | (4-chloro-2-fluorophenyl)-piperazin-1-ylmethanone;hydrochloride |
| InChIKey | XGUVZAAIVISQDJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=C(C=C(C=C2)Cl)F.Cl |
Computed by PubChem (NCBI)