CAS 1240529-60-5 appears in our catalog under these names: 5-Bromo-1-(2-(diethylamino)ethyl)-2,3-dihydro-1H-indole-2,3-dione hydrochloride, 95%, 5-Bromo-1-(2-(diethylamino)ethyl)-2,3-dihydro-1H-indole-2,3-dione hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
5-bromo-1-[2-(diethylamino)ethyl]indole-2,3-dione;hydrochloride (CAS 1240529-60-5) is a chemical compound with the molecular formula C14H18BrClN2O2 and a molecular weight of 361.66 g/mol. IUPAC name: 5-bromo-1-[2-(diethylamino)ethyl]indole-2,3-dione;hydrochloride. InChIKey: HOJYYKTUMKKIEA-UHFFFAOYSA-N.
| Molecular formula | C14H18BrClN2O2 |
|---|---|
| Molecular weight | 361.66 g/mol |
| IUPAC name | 5-bromo-1-[2-(diethylamino)ethyl]indole-2,3-dione;hydrochloride |
| InChIKey | HOJYYKTUMKKIEA-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCN1C2=C(C=C(C=C2)Br)C(=O)C1=O.Cl |
Computed by PubChem (NCBI)