CAS 1240566-28-2 is the registry number for 1-(3,5-Bis(trifluoromethyl)benzyl)-1,4-diazepane, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1,4-diazepane (CAS 1240566-28-2) is a chemical compound with the molecular formula C14H16F6N2 and a molecular weight of 326.28 g/mol. IUPAC name: 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1,4-diazepane. InChIKey: LYBIDGDFZMZSCK-UHFFFAOYSA-N.
| Molecular formula | C14H16F6N2 |
|---|---|
| Molecular weight | 326.28 g/mol |
| IUPAC name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1,4-diazepane |
| InChIKey | LYBIDGDFZMZSCK-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)CC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)