Products 1240584-68-2
CAS 1240584-68-2 is the registry number for tert-Butyl (2R,5R)-2,5-diethylpiperazine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 100mg.
Tert-butyl (2R,5R)-2,5-diethylpiperazine-1-carboxylate (CAS 1240584-68-2) is a chemical compound with the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. IUPAC name: tert-butyl (2R,5R)-2,5-diethylpiperazine-1-carboxylate. InChIKey: CDKIKMMLXSNKCO-GHMZBOCLSA-N.
| Molecular formula | C13H26N2O2 |
|---|---|
| Molecular weight | 242.36 g/mol |
| IUPAC name | tert-butyl (2R,5R)-2,5-diethylpiperazine-1-carboxylate |
| InChIKey | CDKIKMMLXSNKCO-GHMZBOCLSA-N |
| SMILES | CC[C@@H]1CN[C@@H](CN1C(=O)OC(C)(C)C)CC |
Computed by PubChem (NCBI)