Products 1240613-65-3
CAS 1240613-65-3 is the registry number for 1-[(3-Fluorophenyl)acetyl]piperazine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(3-fluorophenyl)-1-piperazin-1-ylethanone;hydrochloride (CAS 1240613-65-3) is a chemical compound with the molecular formula C12H16ClFN2O and a molecular weight of 258.72 g/mol. IUPAC name: 2-(3-fluorophenyl)-1-piperazin-1-ylethanone;hydrochloride. InChIKey: BKWTZXJWOJDQRF-UHFFFAOYSA-N.
| Molecular formula | C12H16ClFN2O |
|---|---|
| Molecular weight | 258.72 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-1-piperazin-1-ylethanone;hydrochloride |
| InChIKey | BKWTZXJWOJDQRF-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)CC2=CC(=CC=C2)F.Cl |
Computed by PubChem (NCBI)