Products 1240801-10-8
CAS 1240801-10-8 appears in our catalog under these names: 3-Azidopropanoic acid-PFP ester, 95.70%, 3-Azidopropanoic acid-PFP ester, 95%, Perfluorophenyl 3-azidopropanoate, 95%, 3-azidopropanoic acid-pfp ester solutio. Offered by: MedChemExpress, Ambeed, BLDpharm, Sigma-Aldrich. Available pack sizes: 50 mg, 100 mg, 25 mg, 250 mg, 1 g, 250mg, 1g, 50mg.
(2,3,4,5,6-pentafluorophenyl) 3-azidopropanoate (CAS 1240801-10-8) is a chemical compound with the molecular formula C9H4F5N3O2 and a molecular weight of 281.14 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 3-azidopropanoate. InChIKey: FRSRZMNVGWVIJB-UHFFFAOYSA-N.
| Molecular formula | C9H4F5N3O2 |
|---|---|
| Molecular weight | 281.14 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 3-azidopropanoate |
| InChIKey | FRSRZMNVGWVIJB-UHFFFAOYSA-N |
| SMILES | C(CN=[N+]=[N-])C(=O)OC1=C(C(=C(C(=C1F)F)F)F)F |
Computed by PubChem (NCBI)