CAS 1241045-80-6 appears in our catalog under these names: 4-Aminocyclohexanol-d10, 4–Aminocyclohexanol–d10. Offered by: TRC, GLPBio. Available pack sizes: 25mg, 5mg.
4-amino-1,2,2,3,3,4,5,5,6,6-decadeuteriocyclohexan-1-ol (CAS 1241045-80-6) is a chemical compound with the molecular formula C6H13NO and a molecular weight of 125.23 g/mol. IUPAC name: 4-amino-1,2,2,3,3,4,5,5,6,6-decadeuteriocyclohexan-1-ol. InChIKey: IMLXLGZJLAOKJN-MBXGXEIXSA-N.
| Molecular formula | C6H13NO |
|---|---|
| Molecular weight | 125.23 g/mol |
| IUPAC name | 4-amino-1,2,2,3,3,4,5,5,6,6-decadeuteriocyclohexan-1-ol |
| InChIKey | IMLXLGZJLAOKJN-MBXGXEIXSA-N |
| SMILES | [2H]C1(C(C(C(C(C1([2H])N)([2H])[2H])([2H])[2H])([2H])O)([2H])[2H])[2H] |
Computed by PubChem (NCBI)