CAS 1241227-58-6 is the registry number for 5-((4-Bromo-3-nitro-1H-pyrazol-1-yl)methyl)-3-methyl-1,2,4-oxadiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-3-methyl-1,2,4-oxadiazole (CAS 1241227-58-6) is a chemical compound with the molecular formula C7H6BrN5O3 and a molecular weight of 288.06 g/mol. IUPAC name: 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-3-methyl-1,2,4-oxadiazole. InChIKey: LFGWWQJRXWNIRA-UHFFFAOYSA-N.
| Molecular formula | C7H6BrN5O3 |
|---|---|
| Molecular weight | 288.06 g/mol |
| IUPAC name | 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-3-methyl-1,2,4-oxadiazole |
| InChIKey | LFGWWQJRXWNIRA-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)CN2C=C(C(=N2)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)