CAS 1241232-31-4 is the registry number for (5-Bromothiophen-2-yl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)methanone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(5-bromothiophen-2-yl)-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methanone (CAS 1241232-31-4) is a chemical compound with the molecular formula C12H10BrNOS2 and a molecular weight of 328.3 g/mol. IUPAC name: (5-bromothiophen-2-yl)-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methanone. InChIKey: PHVLCWQECWTGGT-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNOS2 |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | (5-bromothiophen-2-yl)-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methanone |
| InChIKey | PHVLCWQECWTGGT-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1SC=C2)C(=O)C3=CC=C(S3)Br |
Computed by PubChem (NCBI)