Products 1241256-20-1
CAS 1241256-20-1 is the registry number for N-(5-Bromo-2-iodophenyl)-2-methoxyacetamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(5-bromo-2-iodophenyl)-2-methoxyacetamide (CAS 1241256-20-1) is a chemical compound with the molecular formula C9H9BrINO2 and a molecular weight of 369.98 g/mol. IUPAC name: N-(5-bromo-2-iodophenyl)-2-methoxyacetamide. InChIKey: MMFGCHUGXPNPBZ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrINO2 |
|---|---|
| Molecular weight | 369.98 g/mol |
| IUPAC name | N-(5-bromo-2-iodophenyl)-2-methoxyacetamide |
| InChIKey | MMFGCHUGXPNPBZ-UHFFFAOYSA-N |
| SMILES | COCC(=O)NC1=C(C=CC(=C1)Br)I |
Computed by PubChem (NCBI)