CAS 1241267-89-9 is the registry number for 2-Chloro-4-(((4-fluorophenyl)thio)methyl)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-4-[(4-fluorophenyl)sulfanylmethyl]pyridine (CAS 1241267-89-9) is a chemical compound with the molecular formula C12H9ClFNS and a molecular weight of 253.72 g/mol. IUPAC name: 2-chloro-4-[(4-fluorophenyl)sulfanylmethyl]pyridine. InChIKey: XBBHQWFLVGOGIZ-UHFFFAOYSA-N.
| Molecular formula | C12H9ClFNS |
|---|---|
| Molecular weight | 253.72 g/mol |
| IUPAC name | 2-chloro-4-[(4-fluorophenyl)sulfanylmethyl]pyridine |
| InChIKey | XBBHQWFLVGOGIZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1F)SCC2=CC(=NC=C2)Cl |
Computed by PubChem (NCBI)