CAS 1241275-02-4 is the registry number for N-(Dicyclopropylmethyl)-2-fluorobenzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(dicyclopropylmethyl)-2-fluorobenzenesulfonamide (CAS 1241275-02-4) is a chemical compound with the molecular formula C13H16FNO2S and a molecular weight of 269.34 g/mol. IUPAC name: N-(dicyclopropylmethyl)-2-fluorobenzenesulfonamide. InChIKey: QFNMUOZQXVIVCN-UHFFFAOYSA-N.
| Molecular formula | C13H16FNO2S |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | N-(dicyclopropylmethyl)-2-fluorobenzenesulfonamide |
| InChIKey | QFNMUOZQXVIVCN-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2CC2)NS(=O)(=O)C3=CC=CC=C3F |
Computed by PubChem (NCBI)