CAS 1241283-38-4 is the registry number for 2-(4-Bromo-3-nitro-1H-pyrazol-1-yl)-N,N-dimethylacetamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-bromo-3-nitropyrazol-1-yl)-N,N-dimethylacetamide (CAS 1241283-38-4) is a chemical compound with the molecular formula C7H9BrN4O3 and a molecular weight of 277.08 g/mol. IUPAC name: 2-(4-bromo-3-nitropyrazol-1-yl)-N,N-dimethylacetamide. InChIKey: UQCAHJJSGLOSHX-UHFFFAOYSA-N.
| Molecular formula | C7H9BrN4O3 |
|---|---|
| Molecular weight | 277.08 g/mol |
| IUPAC name | 2-(4-bromo-3-nitropyrazol-1-yl)-N,N-dimethylacetamide |
| InChIKey | UQCAHJJSGLOSHX-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)CN1C=C(C(=N1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)