CAS 1241387-63-2 is the registry number for Decarbonyl Zolmitriptan Dihydrochloride. Offered by: TRC. Available pack sizes: 100mg, 10mg.
(2S)-2-amino-3-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]propan-1-ol;dihydrochloride (CAS 1241387-63-2) is a chemical compound with the molecular formula C15H25Cl2N3O and a molecular weight of 334.3 g/mol. IUPAC name: (2S)-2-amino-3-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]propan-1-ol;dihydrochloride. InChIKey: OGAWTCZKHGHOOU-GXKRWWSZSA-N.
| Molecular formula | C15H25Cl2N3O |
|---|---|
| Molecular weight | 334.3 g/mol |
| IUPAC name | (2S)-2-amino-3-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]propan-1-ol;dihydrochloride |
| InChIKey | OGAWTCZKHGHOOU-GXKRWWSZSA-N |
| SMILES | CN(C)CCC1=CNC2=C1C=C(C=C2)C[C@@H](CO)N.Cl.Cl |
Computed by PubChem (NCBI)