CAS 124152-17-6 is the registry number for 1,3,4-Tri-O-benzoyl-2-deoxy-b-D-ribopyranose. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 1000mg, 500mg, 2000mg.
[(2R,3S,5S)-3,5-dibenzoyloxyoxolan-2-yl]methyl benzoate (CAS 124152-17-6) is a chemical compound with the molecular formula C26H22O7 and a molecular weight of 446.4 g/mol. IUPAC name: [(2R,3S,5S)-3,5-dibenzoyloxyoxolan-2-yl]methyl benzoate. InChIKey: BEODWWVAXXZRMB-ZRBLBEILSA-N.
| Molecular formula | C26H22O7 |
|---|---|
| Molecular weight | 446.4 g/mol |
| IUPAC name | [(2R,3S,5S)-3,5-dibenzoyloxyoxolan-2-yl]methyl benzoate |
| InChIKey | BEODWWVAXXZRMB-ZRBLBEILSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1OC(=O)C2=CC=CC=C2)COC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)