CAS 1241678-73-8 is the registry number for (R)-2-(3,5-Dichloro-2,4,6-trifluorophenyl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(3,5-dichloro-2,4,6-trifluorophenyl)pyrrolidine (CAS 1241678-73-8) is a chemical compound with the molecular formula C10H8Cl2F3N and a molecular weight of 270.07 g/mol. IUPAC name: (2R)-2-(3,5-dichloro-2,4,6-trifluorophenyl)pyrrolidine. InChIKey: AQKVFNLITALIST-SCSAIBSYSA-N.
| Molecular formula | C10H8Cl2F3N |
|---|---|
| Molecular weight | 270.07 g/mol |
| IUPAC name | (2R)-2-(3,5-dichloro-2,4,6-trifluorophenyl)pyrrolidine |
| InChIKey | AQKVFNLITALIST-SCSAIBSYSA-N |
| SMILES | C1C[C@@H](NC1)C2=C(C(=C(C(=C2F)Cl)F)Cl)F |
Computed by PubChem (NCBI)