CAS 1241679-43-5 is the registry number for (S)-2-(3,5-Dibromophenyl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(3,5-dibromophenyl)pyrrolidine (CAS 1241679-43-5) is a chemical compound with the molecular formula C10H11Br2N and a molecular weight of 305.01 g/mol. IUPAC name: (2S)-2-(3,5-dibromophenyl)pyrrolidine. InChIKey: HJLXRQGOWFECKB-JTQLQIEISA-N.
| Molecular formula | C10H11Br2N |
|---|---|
| Molecular weight | 305.01 g/mol |
| IUPAC name | (2S)-2-(3,5-dibromophenyl)pyrrolidine |
| InChIKey | HJLXRQGOWFECKB-JTQLQIEISA-N |
| SMILES | C1C[C@H](NC1)C2=CC(=CC(=C2)Br)Br |
Computed by PubChem (NCBI)