CAS 124168-55-4 appears in our catalog under these names: (3-Chloro-1-benzothien-2-yl)methanol, 95%, (3-chlorobenzo(b)thiophen-2-yl)methanol, 95+%, (3-Chloro-1-benzothien-2-yl)methanol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 250mg, 1g, 5g, 0,5g.
(3-chloro-1-benzothiophen-2-yl)methanol (CAS 124168-55-4) is a chemical compound with the molecular formula C9H7ClOS and a molecular weight of 198.67 g/mol. IUPAC name: (3-chloro-1-benzothiophen-2-yl)methanol. InChIKey: CPGKUHFGNJQXKY-UHFFFAOYSA-N.
| Molecular formula | C9H7ClOS |
|---|---|
| Molecular weight | 198.67 g/mol |
| IUPAC name | (3-chloro-1-benzothiophen-2-yl)methanol |
| InChIKey | CPGKUHFGNJQXKY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(S2)CO)Cl |
Computed by PubChem (NCBI)