CAS 1241680-78-3 is the registry number for (S)-2-(4-Chloro-3-fluorophenyl)pyrrolidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(4-chloro-3-fluorophenyl)pyrrolidine (CAS 1241680-78-3) is a chemical compound with the molecular formula C10H11ClFN and a molecular weight of 199.65 g/mol. IUPAC name: (2S)-2-(4-chloro-3-fluorophenyl)pyrrolidine. InChIKey: UCOPFPGOAGRDCX-JTQLQIEISA-N.
| Molecular formula | C10H11ClFN |
|---|---|
| Molecular weight | 199.65 g/mol |
| IUPAC name | (2S)-2-(4-chloro-3-fluorophenyl)pyrrolidine |
| InChIKey | UCOPFPGOAGRDCX-JTQLQIEISA-N |
| SMILES | C1C[C@H](NC1)C2=CC(=C(C=C2)Cl)F |
Computed by PubChem (NCBI)