Products 1241902-40-8
CAS 1241902-40-8 appears in our catalog under these names: GNE–0439, GNE-0439, GNE-0439, 99.11%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 10 mg, 5 mg, 25 mg, 100 mg, 10mM/1mL.
(2S)-3-methyl-2-[[4-(4-propylcyclohexyl)benzoyl]amino]butanoic acid (CAS 1241902-40-8) is a chemical compound with the molecular formula C21H31NO3 and a molecular weight of 345.5 g/mol. IUPAC name: (2S)-3-methyl-2-[[4-(4-propylcyclohexyl)benzoyl]amino]butanoic acid. InChIKey: SKMKUWKJBZSEJH-RJYAGPCLSA-N.
| Molecular formula | C21H31NO3 |
|---|---|
| Molecular weight | 345.5 g/mol |
| IUPAC name | (2S)-3-methyl-2-[[4-(4-propylcyclohexyl)benzoyl]amino]butanoic acid |
| InChIKey | SKMKUWKJBZSEJH-RJYAGPCLSA-N |
| SMILES | CCCC1CCC(CC1)C2=CC=C(C=C2)C(=O)N[C@@H](C(C)C)C(=O)O |
Computed by PubChem (NCBI)